Home
Products
N-Acetylneuraminic acid
| Product Name | N-Acetylneuraminic acid |
| Price: | $28 / 20mg |
| Catalog No.: | CN06676 |
| CAS No.: | 131-48-6 |
| Molecular Formula: | C11H19NO9 |
| Molecular Weight: | 309.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | White powder |
| Source: | The sialic acid from the bacterium. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]([C@H]([C@@H]1OC(O)(C[C@@H]([C@H]1NC(=O)C)O)C(=O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Acetylneuraminic acid is a nine-carbon, sialic acid monosaccharide commonly found in glycoproteins on cell membranes and in glycolipids such as gangliosides in mammalian cells. Studies suggest that N-Acetylneuraminic acid is useful biologically in neurotransmission, leukocyte extravasation, viral or bacterial infections and carbohydrate-protein recognition. |
| Target | Human Endogenous Metabolite |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 762.3±60.0 °C at 760 mmHg |
| Flash Point | 414.8±32.9 °C |
| Exact Mass | 309.105988 |
| PSA | 176.78000 |
| LogP | -3.98 |
| Vapour Pressure | 0.0±5.8 mmHg at 25°C |