Home
Products
Decursinol angelate
| Product Name | Decursinol angelate |
| Price: | $241 / 10mg |
| Catalog No.: | CN06056 |
| CAS No.: | 130848-06-5 |
| Molecular Formula: | C19H20O5 |
| Molecular Weight: | 328.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica gigas |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Decursinol angelate, a cytotoxic and protein kinase C (PKC) activating agent from the root of Angelica gigas, possesses anti-tumor and anti-inflammatory activities[1][2]. |
| Target | PKC[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 469.4±45.0 °C at 760 mmHg |
| Flash Point | 206.6±28.8 °C |
| Exact Mass | 328.131073 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20℃ |