Home
Products
6-O-benzoylgomisin O
| Product Name | 6-O-benzoylgomisin O |
| Price: | $439 / 10mg |
| Catalog No.: | CN02879 |
| CAS No.: | 130783-32-3 |
| Molecular Formula: | C30H32O8 |
| Molecular Weight: | 520.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The seeds of Schisandra chinensis (Turcz.) Baill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C(OC(=O)c3ccccc3)C(C)C(C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzoylgomisin O isolated from Schisandra rubriflora, has inhibitory activity against 15-LOX, COX-1 and COX-2 enzymes and anti-inflammatory activity[1]. |
| Target | 15-LOX, COX-1, COX-2[1] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 645.1±55.0 °C at 760 mmHg |
| Flash Point | 272.3±31.5 °C |
| Exact Mass | 520.209717 |
| LogP | 7.60 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |