Home
Products
L-Fucitol
| Product Name | L-Fucitol |
| Price: | Inquiry |
| Catalog No.: | CN06481 |
| CAS No.: | 13074-06-1 |
| Molecular Formula: | C6H14O5 |
| Molecular Weight: | 166.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Carum carvi L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]([C@@H]([C@@H]([C@@H](O)C)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Fucitol (1-Deoxy-D-galactitol) is a sugar alcohol isolated from Nutmeg[1]. |
| Density | 1.424g/cm3 |
| Boiling Point | 468ºC at 760mmHg |
| Flash Point | 244.3ºC |
| Exact Mass | 166.08400 |
| PSA | 101.15000 |
| Vapour Pressure | 1.01E-10mmHg at 25°C |