Home
Products
Nitidine chloride
| Product Name | Nitidine chloride |
| Price: | $103 / 20mg |
| Catalog No.: | CN02103 |
| CAS No.: | 13063-04-2 |
| Molecular Formula: | C21H18ClNO4 |
| Molecular Weight: | 383.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The roots of Zanthoxylum nitidum (Roxb.) DC. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c[n+](C)c3c(c2cc1OC)ccc1c3cc2OCOc2c1.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nitidine chloride, a potential anti-malarial lead compound derived from Zanthoxylum nitidum (Roxb) DC, exerts potent anticancer activity through diverse pathways, including inducing apoptosis, inhibiting STAT3 signaling cascade, DNA topoisomerase 1 and 2A, ERK and c-Src/FAK associated signaling pathway. Nitidine chloride inhibits LPS-induced inflammatory cytokines production via MAPK and NF-kB pathway[1][2][3][4][5][6]. |
| Density | 1.35g/cm3 |
| Boiling Point | 619ºC at 760 mmHg |
| Flash Point | 189.4ºC |
| Exact Mass | 383.092438 |
| PSA | 40.80000 |
| LogP | 3.71660 |
| Vapour Pressure | 3.01E-15mmHg at 25°C |
| Storage condition | ?20°C |