Home
Products
Yangambin
| Product Name | Yangambin |
| Price: | Inquiry |
| Catalog No.: | CN02773 |
| CAS No.: | 13060-14-5 |
| Molecular Formula: | C24H30O8 |
| Molecular Weight: | 446.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The leaves of Ocotea duckei Vattimo. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1OC)OC)[C@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Yangambin, a furofuran lignan, is already isolated from plants such as member of the Annonaceae family, including species of the genus Rollinia: R. pickeli, R. exalbidaand R. mucosa, as well from the Magnolia biondii. Yangambin, a selective PAF receptor antagonist, inhibits Ca2+ influx through voltage-gated Ca2+ channels, leading to the reduction in [Ca2+]i in vascular smooth muscle cells and consequent peripheral vasodilation[1]. Yangambin exhibits the antiallergic activity against β-hexosaminidase release with an IC50 of 33.8 μM and for anti-inflammatory activity with an IC50 of 37.4 μM[2]. |
| Target | Ca2+ |
| Density | 1.183g/cm3 |
| Boiling Point | 556.1ºC at 760 mmHg |
| Flash Point | 221.1ºC |
| Exact Mass | 446.19400 |
| PSA | 73.84000 |
| LogP | 3.81340 |
| Vapour Pressure | 7.78E-12mmHg at 25°C |