Home
Products
Liriope muscari baily Saponins C
| Product Name | Liriope muscari baily Saponins C |
| Price: | Inquiry |
| Catalog No.: | CN02428 |
| CAS No.: | 130551-41-6 |
| Molecular Formula: | C44H70O17 |
| Molecular Weight: | 871.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Liriope muscari (Decne.) Baily |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@@H]([C@@H]2O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)O)C)O[C@@H]2C[C@H](O)CC3=CC[C@@H]4[C@@H]([C@@]23C)CC[C@]2([C@H]4C[C@H]3[C@@H]2[C@H](C)[C@]2(O3)CC[C@H](CO2)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Saponin C, from Liriope muscari is isolated from Liriope muscari. |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 870.461304 |
| PSA | 255.91000 |
| LogP | 2.60 |