Home
Products
ent-11alpha-Hydroxyabieta-8(14),13(15)-dien-16,12alpha-olide
| Product Name | ent-11alpha-Hydroxyabieta-8(14),13(15)-dien-16,12alpha-olide |
| Price: | Inquiry |
| Catalog No.: | CN08373 |
| CAS No.: | 130466-20-5 |
| Molecular Formula: | C20H28O3 |
| Molecular Weight: | 316.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Euphorbia ebracteolata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1C2OC(=O)C(=C2C=C2C1C1(C)CCCC(C1CC2)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | ent-11α-Hydroxyabieta-8(14),13(15)-dien-16,12α-olide (compound 12) is a natural bioactive diterpenoid found in the roots of Euphorbia fischeriana[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 504.9±50.0 °C at 760 mmHg |
| Flash Point | 207.8±22.9 °C |
| Exact Mass | 316.203857 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |