Home
Products
Paulownin
| Product Name | Paulownin |
| Price: | $146 / 20mg |
| Catalog No.: | CN02995 |
| CAS No.: | 13040-46-5 |
| Molecular Formula: | C20H18O7 |
| Molecular Weight: | 370.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Paulownia tomentosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC12COC(C1COC2c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Paulownin, a component of wood of Paulownia tomentosa Steud, is a constituent of medicinal plants[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 555.0±50.0 °C at 760 mmHg |
| Flash Point | 289.5±30.1 °C |
| Exact Mass | 370.105255 |
| PSA | 75.61000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | ?20°C |