Home
Products
Dehydrocorydaline nitrate
| Product Name | Dehydrocorydaline nitrate |
| Price: | $204 / 10mg |
| Catalog No.: | CN01095 |
| CAS No.: | 13005-09-9 |
| Molecular Formula: | C22H24NO4.NO3 |
| Molecular Weight: | 428.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis ambigua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | [O-][N+](=O)[O-].COc1cc2CC[n+]3c(c2cc1OC)c(C)c1c(c3)c(OC)c(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydrocorydaline nitrate is isolated from Corydalis edulis Maxim with anti-malarial effects. Dehydrocorydaline nitrate shows strong anti-malarial effects (IC50 =38 nM), and low cytotoxicity (cell viability > 90%) using P. falciparum 3D7 strain[1]. |
| Target | IC50: 38 nM (P. falciparum 3D7 strain)[1] |
| Exact Mass | 428.158356 |
| PSA | 109.68000 |
| LogP | 3.97730 |
| Storage condition | 2-8℃ |