Home
Products
Quinine
| Product Name | Quinine |
| Price: | $23 / 20mg |
| Catalog No.: | CN01407 |
| CAS No.: | 130-95-0 |
| Molecular Formula: | C20H24N2O2 |
| Molecular Weight: | 324.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Cinchona ledgeriana (Howard) Moens ex Trim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2c1cc(OC)cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quinine is an anti-malaria agent and also a potassium channel inhibitor with an IC50 of 169 μM. |
| Target | IC50: 169 μM (potassium channel)[1] Parasite[2] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 495.9±40.0 °C at 760 mmHg |
| Flash Point | 253.7±27.3 °C |
| Exact Mass | 324.183777 |
| PSA | 45.59000 |
| LogP | 3.44 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |