Home
Products
Ascorbyl glucoside
| Product Name | Ascorbyl glucoside |
| Price: | Inquiry |
| Catalog No.: | CN06334 |
| CAS No.: | 129499-78-1 |
| Molecular Formula: | C12H18O11 |
| Molecular Weight: | 338.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Ziziphus jujuba Mill. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@H]([C@H]1OC(=O)C(=C1O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-O-α-D-Glucopyranosyl-L-ascorbic Acid is a glucoside derivative of ascorbic acid, shows anti-cancer activity after enzymatic hydrolysis to ascorbic acid[1]. |
| Density | 1.83±0.1 g/cm3 |
| Boiling Point | 785.6±60.0 °C at 760 mmHg |
| Flash Point | 296.5±26.4 °C |
| Exact Mass | 338.084900 |
| PSA | 186.37000 |
| LogP | -2.57 |
| Vapour Pressure | 0.0±6.2 mmHg at 25°C |
| Storage condition | 2-8°C |