Home
Products
Semilicoisoflavone B
| Product Name | Semilicoisoflavone B |
| Price: | Inquiry |
| Catalog No.: | CN04817 |
| CAS No.: | 129280-33-7 |
| Molecular Formula: | C20H16O6 |
| Molecular Weight: | 352.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis Fisch |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)occ(c2=O)c1cc(O)c2c(c1)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Semilicoisoflavone B, an isoflavone, mainly derived from Glycyrrhiza uralensis Fisch.. Semilicoisoflavone B reduces amyloid β (Aβ) secretion by inhibiting β-secretase-1 (BACE1) expression and activity. Semilicoisoflavone B decreases BACE1 expression mainly through increasing PPARγ expression and inhibiting STAT3 phosphorylation[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 615.5±55.0 °C at 760 mmHg |
| Flash Point | 225.5±25.0 °C |
| Exact Mass | 352.094696 |
| PSA | 100.13000 |
| LogP | 4.48 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |