Home
Products
Aurantio-obtusin beta-D-glucoside
| Product Name | Aurantio-obtusin beta-D-glucoside |
| Price: | $424 / 10mg |
| Catalog No.: | CN05941 |
| CAS No.: | 129025-96-3 |
| Molecular Formula: | C23H24O12 |
| Molecular Weight: | 492.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia obtusifolia L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3C(=O)c4cc(C)c(c(c4C(=O)c3c(c2OC)O)OC)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aurantio-obtusin β-D-glucoside (Glucoaurantio-obtusin), isolated from Cassiae Semen (seeds of Cassia tora), is a glucoside of aurantio-obtusin[1]. |
| Density | 1.602g/cm3 |
| Boiling Point | 845ºC at 760mmHg |
| Flash Point | 292.1ºC |
| Exact Mass | 492.12700 |
| PSA | 192.44000 |
| Vapour Pressure | 2.4E-30mmHg at 25°C |
| Storage condition | 2-8°C |