Home
Products
Maohuoside A
| Product Name | Maohuoside A |
| Price: | $293 / 10mg |
| Catalog No.: | CN05397 |
| CAS No.: | 128988-55-6 |
| Molecular Formula: | C27H32O12 |
| Molecular Weight: | 548.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Epimedium brevicornu Maxim |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2CCC(O)(C)C)oc(c(c3=O)O)c2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maohuoside A, a single compound isolated from the E. koreanum that potently promotes osteogenesis. Maohuoside A enhances the osteogenesis of bone marrow-derived mesenchymal stem cells via bone morphogenetic protein (BMP) and MAPK signaling pathways[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 838.2±65.0 °C at 760 mmHg |
| Flash Point | 278.8±27.8 °C |
| Exact Mass | 548.189392 |
| PSA | 199.51000 |
| LogP | 0.86 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |