Home
Products
Kalopanaxsaponin H
| Product Name | Kalopanaxsaponin H |
| Price: | $293 / 5mg |
| Catalog No.: | CN07747 |
| CAS No.: | 128730-82-5 |
| Molecular Formula: | C47H76O17 |
| Molecular Weight: | 913.09 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedera nepalensis K. Koch var. sinensis (Tobl.) Rehd |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(O)C(OC3C(OCC(C3O)O)OC3CCC4(C(C3(C)CO)CCC3(C4CC=C4C3(C)CCC3(C4CC(C)(C)CC3)C(=O)O)C)C)OC(C2O)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Macranthoside A is a triterpene glycoside with anti-microbially activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1006.9±65.0 °C at 760 mmHg |
| Flash Point | 288.4±27.8 °C |
| Exact Mass | 912.508240 |
| PSA | 274.75000 |
| LogP | 5.90 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |