Home
Products
Hydroprotopine
| Product Name | Hydroprotopine |
| Price: | $62 / 10mg |
| Catalog No.: | CN02222 |
| CAS No.: | 128397-41-1 |
| Molecular Formula: | C20H20NO5 |
| Molecular Weight: | 354.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Macleaya cordata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[N+]12CCc3c(C2(O)Cc2c(C1)c1OCOc1cc2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroprotopine is a alkaloid from Hypecoum leptocarpumand. Leptopidine can suppress growth and induce cytotoxicity in breast cancer cells and that the cytotoxicity of leptopidine may be related to its inhibitory effect on fatty acid synthase expression[1]. |
| Exact Mass | 354.13400 |
| PSA | 57.15000 |
| LogP | 2.00690 |