Home
Products
1-(3,4-Dimethoxycinnamoyl)piperidine
| Product Name | 1-(3,4-Dimethoxycinnamoyl)piperidine |
| Price: | $351 / 10mg |
| Catalog No.: | CN01062 |
| CAS No.: | 128261-84-7 |
| Molecular Formula: | C16H21NO3 |
| Molecular Weight: | 275.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper longum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)N2CCCCC2)ccc1OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-(3,4-Dimethoxycinnamoyl)piperidine, a synthesized piperidine analog, possesses antimicrobial and antioxidant activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 469.2±33.0 °C at 760 mmHg |
| Flash Point | 237.6±25.4 °C |
| Exact Mass | 275.152130 |
| PSA | 38.77000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |