Home
Products
Sennoside B
| Product Name | Sennoside B |
| Price: | $43 / 20mg |
| Catalog No.: | CN05994 |
| CAS No.: | 128-57-4 |
| Molecular Formula: | C42H38O20 |
| Molecular Weight: | 862.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Cassia angustifolia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c([C@@H]3[C@@H]3c4cc(cc(c4C(=O)c4c3cccc4O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O)C(=O)O)cc(cc2O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sennoside B is an anthraquinone glycoside, found in large quantities in leaves and pods of Senna (Cassia angustifolia)[1]. Sennoside B can inhibit PDGF-stimulated cell proliferation by binding to PDGF-BB and its receptor and by down-regulating the PDGFR-beta signaling pathway[2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1144.8±65.0 °C at 760 mmHg |
| Flash Point | 348.6±27.8 °C |
| Exact Mass | 862.195618 |
| PSA | 347.96000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |