Home
Products
5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate
| Product Name | 5-Hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-yl acetate |
| Price: | Inquiry |
| Catalog No.: | CN03693 |
| CAS No.: | 1269839-24-8 |
| Molecular Formula: | C21H26O5 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The rhizomes of Zingiber officinale |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H](C[C@H](OC(=O)C)CCc1ccc(cc1)O)CCc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 565.6±50.0 °C at 760 mmHg |
| Flash Point | 197.1±23.6 °C |
| Exact Mass | 358.178009 |
| PSA | 86.99000 |
| LogP | 3.22 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |