Home
Products
5,7,3'-Trihydroxy-4'-methoxy-8-prenylflavanone
| Product Name | 5,7,3'-Trihydroxy-4'-methoxy-8-prenylflavanone |
| Price: | Inquiry |
| Catalog No.: | CN05165 |
| CAS No.: | 1268140-15-3 |
| Molecular Formula: | C21H22O6 |
| Molecular Weight: | 370.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The barks of Azadirachta indica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1O)[C@@H]1CC(=O)c2c(O1)c(CC=C(C)C)c(cc2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 616.0±55.0 °C at 760 mmHg |
| Flash Point | 219.1±25.0 °C |
| Exact Mass | 370.141632 |
| PSA | 96.22000 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |