Home
Products
(2R,3S)-Dihydrodehydroconiferyl alcohol
| Product Name | (2R,3S)-Dihydrodehydroconiferyl alcohol |
| Price: | Inquiry |
| Catalog No.: | CN02698 |
| CAS No.: | 126253-41-6 |
| Molecular Formula: | C20H24O6 |
| Molecular Weight: | 360.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides Oliver |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCCCc1cc2c(c(c1)OC)O[C@@H]([C@H]2CO)c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 540.9±50.0 °C at 760 mmHg |
| Flash Point | 280.9±30.1 °C |
| Exact Mass | 360.157288 |
| PSA | 88.38000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |