Home
Products
Atractyloside A
| Product Name | Atractyloside A |
| Price: | $293 / 20mg |
| Catalog No.: | CN09439 |
| CAS No.: | 126054-77-1 |
| Molecular Formula: | C21H36O10 |
| Molecular Weight: | 448.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Atractylodes lancea (Thunb.) DC. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC([C@@H]2CC[C@]([C@@H]3[C@@H](C2)[C@](C)(O)C(=O)C3)(O)CO)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atractyloside A(126054-77-1) is a natural TCM reference compound. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 684.8±55.0 °C at 760 mmHg |
| Flash Point | 234.1±25.0 °C |
| Exact Mass | 448.230835 |
| PSA | 177.14000 |
| LogP | -3.63 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
| Storage condition | -20°C |