Home
Products
Carminic acid
| Product Name | Carminic acid |
| Price: | Inquiry |
| Catalog No.: | CN05955 |
| CAS No.: | 1260-17-9 |
| Molecular Formula: | C22H20O13 |
| Molecular Weight: | 492.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | From cochineal insects (Dactylopius spp.) |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)c2c(c(c1O)O)C(=O)c1c(C2=O)c(C)c(c(c1)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Carminic acid is a natural red colorant, which belongs to the coccid dye family[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 907.6±65.0 °C at 760 mmHg |
| Flash Point | 316.1±27.8 °C |
| Exact Mass | 492.090393 |
| PSA | 242.51000 |
| LogP | 4.80 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |