Home
Products
Polygalic acid
| Product Name | Polygalic acid |
| Price: | $103 / 20mg |
| Catalog No.: | CN07704 |
| CAS No.: | 1260-04-4 |
| Molecular Formula: | C29H44O6 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia Willd |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@]1(C)[C@@H](O)[C@@H](O)C[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)C[C@@H](O)[C@@]1([C@H]2CC(CC1)(C)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polygalic acid, a triterpenoid saponin, is considered one of the major active constituents of Polygala tenuifolia[1]. |
| Density | 1.25 |
| Exact Mass | 488.31400 |
| PSA | 115.06000 |
| LogP | 5.02310 |