Home
Products
Lavendustin B
| Product Name | Lavendustin B |
| Price: | Inquiry |
| Catalog No.: | CN01864 |
| CAS No.: | 125697-91-8 |
| Molecular Formula: | C21H19NO5 |
| Molecular Weight: | 365.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | From Streptomyces griseolavendus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccccc1CN(c1ccc(c(c1)C(=O)O)O)Cc1ccccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lavendustin B is an inhibitor of HIV-1 integrase interaction with LEDGF/p75 with an IC50 of 94.07 μM. Lavendustin B is an ATP-competitive GLUT1 inhibitor with a Ki of 15 µM. Lavendustin B is also a weak inhibitor of tyrosine kinases[1][2]. |
| Target | GLUT1:15 μM (Ki) HIV-1 integrase interaction with LEDGF/p75:94.07 μM (IC50) |
| In Vitro | In HL-60 cells, Lavendustin B (0-1000 µM) inhibits the uptake of methylglucose, deoxyglucose, and dehydroascorbic acid in human erythrocytes in a dose-dependent manner, with 50% inhibition observed at approximately 10-30 µM. Moreover, increasing concentrations of Lavendustin B inhibited, in a dose-dependent manner, the binding of cytochalasin B to human erythrocyte membranes[1]. |
| Density | 1.423 g/cm3 |
| Boiling Point | 671.1ºC at 760 mmHg |
| Flash Point | 359.7ºC |
| Exact Mass | 365.12600 |
| PSA | 101.23000 |
| LogP | 3.70840 |
| Vapour Pressure | 6.31E-19mmHg at 25°C |