Home
Products
Blinin
| Product Name | Blinin |
| Price: | $146 / 20mg |
| Catalog No.: | CN08245 |
| CAS No.: | 125675-09-4 |
| Molecular Formula: | C22H32O6 |
| Molecular Weight: | 392.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Acroptilon repens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1=C[C@@H](O)C[C@H]2[C@]1(CC[C@H]([C@]2(C)CCC1=CC(=O)OC1)C)COC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Blinin is a neoclerodane diterpene, isolated from the whole plant of Conyza blinii[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 565.7±30.0 °C at 760 mmHg |
| Flash Point | 192.5±18.1 °C |
| Exact Mass | 392.219879 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |