Home
Products
Dracorhodin perchlorate
| Product Name | Dracorhodin perchlorate |
| Price: | $143 / 20mg |
| Catalog No.: | CN05155 |
| CAS No.: | 125536-25-6 |
| Molecular Formula: | C17H15ClO7 |
| Molecular Weight: | 366.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Red powder |
| Source: | The herbs of Daemonorops draco Bl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | [O-][Cl](=O)(=O)=O.COc1c(C)c(O)cc2c1ccc([o+]2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dracorhodin perchlorate (Dracohodin perochlorate) is a natural product extracted from a natural medicine Dragon's blood. Dracorhodin perchlorate (Dracohodin perochlorate) inhibits cell proliferation, induces cell cycle arrest and apoptosis [1][2]. |
| Exact Mass | 366.050629 |
| PSA | 116.87000 |
| LogP | 4.61780 |