Home
Products
Asiaticoside B
| Product Name | Asiaticoside B |
| Price: | $103 / 10mg |
| Catalog No.: | CN07229 |
| CAS No.: | 125265-68-1 |
| Molecular Formula: | C48H78O20 |
| Molecular Weight: | 975.13 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Centella asiatica (L.) Urban |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)C[C@@H](O)[C@@H]5[C@]6(C)C[C@H]([C@@H]([C@@]5(C)CO)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Asiaticoside B is a triterpene glycoside isolated from Actaea asiatica, with anti-cancer activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1040.5±65.0 °C at 760 mmHg |
| Flash Point | 294.8±27.8 °C |
| Exact Mass | 974.508667 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |