Home
Products
Rosthornin B
| Product Name | Rosthornin B |
| Price: | Inquiry |
| Catalog No.: | CN08931 |
| CAS No.: | 125181-21-7 |
| Molecular Formula: | C24H34O7 |
| Molecular Weight: | 434.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia rosthornii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC1(C)CCCC2(C1CC(O)C13C2C(OC(=O)C)CC(C1)(C(=C)C3=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rosthornin B is a ent-kaurene diterpenoid compound, isolated from the ether extract of the dried leaves of Rabdosia rosthornii[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 556.1±50.0 °C at 760 mmHg |
| Flash Point | 183.9±23.6 °C |
| Exact Mass | 434.230438 |
| PSA | 110.13000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |