Home
Products
Hexamethylquercetagetin
| Product Name | Hexamethylquercetagetin |
| Price: | $611 / 5mg |
| Catalog No.: | CN04512 |
| CAS No.: | 1251-84-9 |
| Molecular Formula: | C21H22O8 |
| Molecular Weight: | 402.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus nobilis Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1OC)c1oc2cc(OC)c(c(c2c(=O)c1OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hexamethylquercetagetin is a polymethoxylated flavone in peels of citrus cultivars. |
| Exact Mass | 402.13100 |
| PSA | 85.59000 |
| LogP | 3.51160 |
| Vapour Pressure | 1.91E-13mmHg at 25°C |