Home
Products
Vomicine
| Product Name | Vomicine |
| Price: | Inquiry |
| Catalog No.: | CN00970 |
| CAS No.: | 125-15-5 |
| Molecular Formula: | C22H24N2O4 |
| Molecular Weight: | 380.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seeds of Strychnos nux-vomica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN1CCC23C(=O)CC4C(=CCOC5C4C2N(c2c3cccc2O)C(=O)C5)C1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vomicine, an alkaloid isolated from seeds of S. nux-vomica, shows antidiabetic activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 636.9±55.0 °C at 760 mmHg |
| Flash Point | 339.0±31.5 °C |
| Exact Mass | 380.173615 |
| PSA | 70.08000 |
| LogP | 0.47 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |