Home
Products
Isobornyl acetate
| Product Name | Isobornyl acetate |
| Price: | Inquiry |
| Catalog No.: | CN09610 |
| CAS No.: | 125-12-2 |
| Molecular Formula: | C12H20O2 |
| Molecular Weight: | 196.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The leaves of Tsuga canadensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1C[C@@H]2C([C@@]1(C)CC2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobornyl acetate is a fragrance compound[1]. |
| Density | 0.983 g/mL at 25 °C(lit.) |
| Boiling Point | 229-233 °C(lit.) |
| Flash Point | 190 °F |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 2.76430 |
| Vapour Pressure | 0.0959mmHg at 25°C |