Home
Products
Raddeanoside R8
| Product Name | Raddeanoside R8 |
| Price: | $77 / 5mg |
| Catalog No.: | CN07485 |
| CAS No.: | 124961-61-1 |
| Molecular Formula: | C65H106O30 |
| Molecular Weight: | 1367.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Anemone raddeana Regel |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@]34CC[C@@]5(C(=CC[C@H]6[C@@]5(C)CC[C@@H]5[C@]6(C)CC[C@@H](C5(C)C)O[C@@H]5OC[C@@H]([C@@H]([C@H]5O[C@@H]5O[C@@H](C)[C@@H]([C@H]([C@H]5O)O)O)O)O[C@@H]5O[C@H](CO)[C@H]([C@@H]([C@H]5O)O)O)[C@@H]4CC(CC3)(C)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Raddeanoside R8 is a saponin that can be isolated from fresh rhizoma of Anemone raddeana Regel[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1366.676880 |
| PSA | 471.74000 |
| LogP | 3.86 |
| Storage condition | 2-8℃ |