Home
Products
Daidzin 6''-O-malonate
| Product Name | Daidzin 6''-O-malonate |
| Price: | $556 / 5mg |
| Catalog No.: | CN04543 |
| CAS No.: | 124590-31-4 |
| Molecular Formula: | C24H22O12 |
| Molecular Weight: | 502.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)CC(=O)OCC1OC(Oc2ccc3c(c2)occ(c3=O)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.595g/cm3 |
| Boiling Point | 824.8ºC at 760 mmHg |
| Flash Point | 284ºC |
| Exact Mass | 502.11100 |
| PSA | 193.19000 |
| LogP | 0.36990 |
| Vapour Pressure | 8.29E-29mmHg at 25°C |
| Storage condition | 2-8°C |