Home
Products
1-Caffeoylquinic acid
| Product Name | 1-Caffeoylquinic acid |
| Price: | $290 / 10mg |
| Catalog No.: | CN07036 |
| CAS No.: | 1241-87-8 |
| Molecular Formula: | C16H18O9 |
| Molecular Weight: | 354.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The herb of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC1(CC(O)C(C(C1)O)O)C(=O)O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1-Caffeoylquinic acid is an effective NF-κB inhibitor, shows significant binding affinity to the RH domain of p105 with Ki of 0.002 μM and binding energy of 1.50 Kcal/mol[1]. 1-Caffeoylquinic acid has anti-oxidative stress ability[2]. 1-Caffeoylquinic acid inhibits PD-1/PD-L1 interact[3]. |
| Target | Ki: 0.002 μM (1-Caffeoylquinic acid)[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 636.2±55.0 °C at 760 mmHg |
| Flash Point | 234.5±25.0 °C |
| Exact Mass | 354.095093 |
| PSA | 164.75000 |
| LogP | 0.06 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |