Home
Products
Isoborneol
| Product Name | Isoborneol |
| Price: | $23 / 20mg |
| Catalog No.: | CN09630 |
| CAS No.: | 124-76-5 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Blumea balsamifera. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@@H]2C([C@@]1(C)CC2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoborneol ((±)-Isoborneol) is a monoterpenoid alcohol present in the essential oils of numerous medicinal plants and has antioxidant and antiviral properties. Isoborneol is a potent inhibitor of herpes simplex virus type 1 (HSV-1)[1][2]. |
| Target | HSV-1 |
| In Vitro | Isoborneol ((±)-Isoborneol) protects against 6-OHDA-induced increases in caspase-3 activity and cytochrome C translocation into the cytosol from mitochondria. Isoborneol prevents 6-OHDA from decreasing the Bax/Bcl-2 ratio[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 212.0±0.0 °C at 760 mmHg |
| Flash Point | 65.6±0.0 °C |
| Exact Mass | 154.135757 |
| PSA | 20.23000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |