Home
Products
Hypocrellin B
| Product Name | Hypocrellin B |
| Price: | $92 / 10mg |
| Catalog No.: | CN05969 |
| CAS No.: | 123940-54-5 |
| Molecular Formula: | C30H26O10 |
| Molecular Weight: | 546.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | From Hypocrella bambusae |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2C(=O)C(=O)C(=C3c4c2c2c1c(OC)cc(c2c1c4c(=C(C3)C)c(c(c1O)OC)C(=O)C)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hypocrellin B, a pigment isolated from the fungi Hypocrella bambusae and Shiraia bambusicola, is an apoptosis inducer. Hypocrellin B can be used as a photosensitizer for photodynamic therapy of cancer. Hypocrellin B also has antimicrobial and antileishmanial activities[1][2][3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 893.8±65.0 °C at 760 mmHg |
| Flash Point | 301.4±27.8 °C |
| Exact Mass | 528.142029 |
| PSA | 128.59000 |
| LogP | 5.57 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |