Home
Products
Osmundacetone
| Product Name | Osmundacetone |
| Price: | Inquiry |
| Catalog No.: | CN03431 |
| CAS No.: | 123694-03-1 |
| Molecular Formula: | C10H10O3 |
| Molecular Weight: | 178.2 g/mol |
| Purity: | >95% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Osmunda japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (E)-Osmundacetone is the isomer of Osmundacetone. Osmundacetone significantly suppresses the phosphorylation of MAPKs, including JNK, ERK, and p38 kinases. Osmundacetone has a neuroprotective effect against oxidative stress[1]. |
| Density | 1.264g/cm3 |
| Boiling Point | 382.5ºC at 760mmHg |
| Flash Point | 199.3ºC |
| Exact Mass | 178.06300 |
| PSA | 57.53000 |
| LogP | 1.70000 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | 2-8℃ |