Home
Products
Bulleyanin
| Product Name | Bulleyanin |
| Price: | Inquiry |
| Catalog No.: | CN08933 |
| CAS No.: | 123043-54-9 |
| Molecular Formula: | C28H38O10 |
| Molecular Weight: | 534.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia bulleyana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1C(O)C2CC3(C1C1(C)C(OC(=O)C)CC(C(C1CC3OC(=O)C)(C)C)OC(=O)C)C(=O)C2=C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bulleyanin is a compound isolated from isodon species (Labiatae)[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 600.9±55.0 °C at 760 mmHg |
| Flash Point | 189.1±25.0 °C |
| Exact Mass | 534.246521 |
| PSA | 142.50000 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |