Home
Products
2-Desoxy-4-epi-pulchellin
| Product Name | 2-Desoxy-4-epi-pulchellin |
| Price: | $146 / 5mg |
| Catalog No.: | CN09540 |
| CAS No.: | 122872-03-1 |
| Molecular Formula: | C15H22O3 |
| Molecular Weight: | 250.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Carpesium abrotanoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1C(=O)O[C@@H]2[C@@H]1C[C@]1(C)[C@@H](O)CC[C@H]1[C@@H](C2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2-Desoxy-4-epi-pulchellin (compound 13) is a compound isolated from dichloromethane-soluble portion of Polygonum hydropiper[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 408.2±45.0 °C at 760 mmHg |
| Flash Point | 171.6±21.5 °C |
| Exact Mass | 250.156891 |
| PSA | 46.53000 |
| LogP | 1.96 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |