Home
Products
Garbanzol
| Product Name | Garbanzol |
| Price: | Inquiry |
| Catalog No.: | CN04738 |
| CAS No.: | 1226-22-8 |
| Molecular Formula: | C15H12O5 |
| Molecular Weight: | 272.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Cicer arietinum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)[C@H]1Oc2cc(O)ccc2C(=O)[C@@H]1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Garbanzol is a natural product that can be isolated from the heartwood of Rhus verniciflua[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 590.1±50.0 °C at 760 mmHg |
| Flash Point | 229.7±23.6 °C |
| Exact Mass | 272.068481 |
| PSA | 86.99000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |