Home
Products
Paederosidic acid methyl ester
| Product Name | Paederosidic acid methyl ester |
| Price: | $293 / 10mg |
| Catalog No.: | CN03100 |
| CAS No.: | 122413-01-8 |
| Molecular Formula: | C19H26O12S |
| Molecular Weight: | 478.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Paederia scandens (Lour.) Merr |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2C(=C[C@@H]3O)COC(=O)SC)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Paederosidic acid methyl ester is a ATP‐sensitive K+ channel activator, isolated from P. scandens. Paederosidic acid methyl ester exhibits significant central analgesic activity, and enhances the threshold of pain by activating ATP‐sensitive K+ channel in the brain and spinal cord level[1]. |
| Target | IC50: K+ channel[1] |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 711.2±70.0 °C at 760 mmHg |
| Flash Point | 383.9±35.7 °C |
| Exact Mass | 478.114502 |
| PSA | 206.74000 |
| LogP | -1.72 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |