Home
Products
Gymnemic acid I
| Product Name | Gymnemic acid I |
| Price: | Inquiry |
| Catalog No.: | CN07628 |
| CAS No.: | 122168-40-5 |
| Molecular Formula: | C43H66O14 |
| Molecular Weight: | 806.97 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Gymnema sylvestre (Retz.) Schult. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C/C=C(/C(=O)O[C@H]1[C@H](O)[C@]2(COC(=O)C)[C@@H](O)C[C@@]3(C(=CC[C@H]4[C@@]3(C)CC[C@@H]3[C@]4(C)CC[C@@H]([C@@]3(C)CO)O[C@@H]3O[C@H](C(=O)O)[C@H]([C@@H]([C@H]3O)O)O)[C@@H]2CC1(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gymnemic acid I is a bioactive triterpene saponin found in Gymnema sylvestre. Gymnemic acid I decreases the apoptosis under the high glucose stress[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 872.1±65.0 °C at 760 mmHg |
| Flash Point | 252.8±27.8 °C |
| Exact Mass | 806.445251 |
| PSA | 229.74000 |
| LogP | 4.74 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |