Home
Products
3,4-Dihydro-3,4-dihydroxynaphthalen-1(2H)-one
| Product Name | 3,4-Dihydro-3,4-dihydroxynaphthalen-1(2H)-one |
| Price: | Inquiry |
| Catalog No.: | CN06738 |
| CAS No.: | 1220891-22-4 |
| Molecular Formula: | C10H10O3 |
| Molecular Weight: | 178.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Impatiens balsamina |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC(=O)c2c([C@@H]1O)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 346.3±42.0 °C at 760 mmHg |
| Flash Point | 177.4±24.4 °C |
| Exact Mass | 178.062988 |
| PSA | 57.53000 |
| LogP | 0.47 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |