Home
Products
Rebaudioside M
| Product Name | Rebaudioside M |
| Price: | $117 / 10mg |
| Catalog No.: | CN08217 |
| CAS No.: | 1220616-44-3 |
| Molecular Formula: | C56H90O33 |
| Molecular Weight: | 1291.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Stevia rebaudiana Bertoni. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@]2(C)CCC[C@@]3([C@@H]2CC[C@@]24[C@H]3CC[C@](C4)(C(=C)C2)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rebaudioside M, a glycoside of the ent-kaurene diterpenoid aglycone, is a natural non-calorie sweetener isolated from Stevia rebaudiana Bertoni[1]. |
| Density | 1.67±0.1g/ml(Predicted) |