Home
Products
Magnesium Lithospermate B
| Product Name | Magnesium Lithospermate B |
| Price: | Inquiry |
| Catalog No.: | CN06919 |
| CAS No.: | 122021-74-3 |
| Molecular Formula: | C36H28MgO16 |
| Molecular Weight: | 740.90 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC(C(=O)[O-])Cc1ccc(c(c1)O)O)C=Cc1ccc(c2c1C(C(=O)OC(C(=O)[O-])Cc1ccc(c(c1)O)O)C(O2)c1ccc(c(c1)O)O)O.[Mg+2] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Magnesium Lithospermate B is a derivative of caffeic acid tetramer and extracted from Salviae miltiorrhizae. Magnesium Lithospermate B is widely used for the research of cardiovascular diseases, and it can protect against glucose-induced intracellular oxidative damage. Magnesium Lithospermate B also suppresses neuroinflammation and attenuates neurodegeneration[1][2][3]. |
| In Vitro | Magnesium Lithospermate B (20-60 μg/ml; 24 h) decreases LDH activity in the cultured supernatant, increases SOD activity in cardiomyocytes, reduces intracellular ROS and MDA levels, and significantly suppresses cardiomyocytes apoptosis[2]. Magnesium Lithospermate B (1-100 μg/ml) enhances proliferation of neural stem cells (NSCs) in a dose-dependent manner[3]. Magnesium Lithospermate B (10 μg/ml) promotes the differentiation in vitro of NSCs towards neurons[3]. |
| In Vivo | Magnesium Lithospermate B (2-8 mg/kg; p.o. once daily for 16 d) reduces the renal damage of oxidative stress through reduction of reactive oxygen species in old rats[1]. Magnesium Lithospermate B (0.5 μg/g; s.c. for 6 weeks) promotes the neurogenesis and improves the memory in PD models[3]. Animal Model: Young (5-month-old) and old (20-month-old) specific-pathogen-free male Sprague-Dawley rats[1] Dosage: 2, 8 mg/kg Administration: P.o. once daily for 16 days Result: Reduced the protein expression of major subunits of nicotinamide adenine dinucleotide phosphate oxidase (Nox4 and p22phox), phospho-p38, nuclear factor-kappa B p65, cyclooxygenase-2, and inducible nitric oxide synthase. Showed lower levels of senescence-related proteins such as p16, ADP-ribosylation factor 6, p53, and p21. |
| Boiling Point | 1020.3ºC at 760mmHg |
| Flash Point | 322.1ºC |
| Exact Mass | 740.122803 |
| PSA | 283.70000 |
| LogP | 4.21090 |
| Vapour Pressure | 0mmHg at 25°C |