Home
Products
Glycerine trioleate
| Product Name | Glycerine trioleate |
| Price: | $31 / 20mg |
| Catalog No.: | CN06608 |
| CAS No.: | 122-32-7 |
| Molecular Formula: | C57H104O6 |
| Molecular Weight: | 885.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The leaves of Canarium album |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCC=CCCCCCCCC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triolein is a symmetrical triacylglycerol, reduces MMP-1 upregulation, with strong antioxidant and anti-inflammatory properties[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 818.7±55.0 °C at 760 mmHg |
| Flash Point | 302.7±31.5 °C |
| Exact Mass | 884.783264 |
| PSA | 78.90000 |
| LogP | 23.71 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8°C |