Home
Products
6-Benzyladenine
| Product Name | 6-Benzyladenine |
| Price: | $15 / 20mg |
| Catalog No.: | CN00067 |
| CAS No.: | 1214-39-7 |
| Molecular Formula: | C12H11N5 |
| Molecular Weight: | 225.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | c1ccc(cc1)CNc1ncnc2c1[nH]cn2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6-Benzylaminopurine is a first-generation synthetic cytokinin that elicits plant growth and development, also is an inhibitor of respiratory kinase in plants, increases post-harvest life of green vegetables. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 387.5±52.0 °C at 760 mmHg |
| Flash Point | 188.1±30.7 °C |
| Exact Mass | 225.101440 |
| PSA | 66.49000 |
| LogP | 0.28 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |