Home
Products
3'-Nitroacetophenone
| Product Name | 3'-Nitroacetophenone |
| Price: | Inquiry |
| Catalog No.: | CN06622 |
| CAS No.: | 121-89-1 |
| Molecular Formula: | C8H7NO3 |
| Molecular Weight: | 165.15 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Styrax tonkinensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)c1cccc(c1)[N+](=O)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 237.3±13.0 °C at 760 mmHg |
| Flash Point | 99.9±12.6 °C |
| Exact Mass | 165.042587 |
| PSA | 62.89000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |